C33H35FN8O5 — CID 146047868
N-[4-[4-amino-7-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-ethyl-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 146047868) has the molecular formula C33H35FN8O5 and a molecular weight of 642.69 g/mol. Its IUPAC name is N-[4-[4-amino-7-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-ethyl-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-[4-[4-amino-7-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-ethyl-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 146047868 |
| Molecular Formula | C33H35FN8O5 |
| Molecular Weight | 642.69 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | N-[4-[4-amino-7-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-ethyl-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | CCN1CC(C(=O)Nc2ccc(-c3cc(C4CCN(C(=O)[C@@H](C)O)CC4)n4ncnc(N)c34)cc2)C(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C33H35FN8O5/c1-3-39-17-26(32(46)41(33(39)47)24-10-6-22(34)7-11-24)30(44)38-23-8-4-20(5-9-23)25-16-27(42-28(25)29(35)36-18-37-42)21-12-14-40(15-13-21)31(45)19(2)43/h4-11,16,18-19,21,26,43H,3,12-15,17H2,1-2H3,(H,38,44)(H2,35,36,37)/t19-,26?/m1/s1 |
| InChIKey | VAFODSRCWOIOFJ-ICCFGIFFSA-N |
| XLogP | 3.25 |
| TPSA | 166.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|