About 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one
2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one (PubChem CID 146047936) has the molecular formula C13H12ClN3O
and a molecular weight of 261.71 g/mol. Its IUPAC name is 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one.
Molecular Properties
| Compound Name | 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one |
| PubChem CID | 146047936 |
| Molecular Formula | C13H12ClN3O |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one |
| SMILES | O=C1NCCc2c1nn(Cc1ccccc1)c2Cl |
| InChI | InChI=1S/C13H12ClN3O/c14-12-10-6-7-15-13(18)11(10)16-17(12)8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,15,18) |
| InChIKey | CIMXMDXSOWANAU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one?
The IUPAC name of 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one (CID 146047936) is 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one.
What is the SMILES notation for 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one?
The canonical SMILES for 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one is O=C1NCCc2c1nn(Cc1ccccc1)c2Cl.
What is the InChIKey of 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one?
The InChIKey is CIMXMDXSOWANAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN3O/c14-12-10-6-7-15-13(18)11(10)16-17(12)8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,15,18).
What are the key properties of 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one?
2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one has a molecular weight of 261.71 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3-chloro-5,6-dihydro-4H-pyrazolo[3,4-c]pyridin-7-one is sourced from PubChem (CID 146047936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).