C28H27N2O4+ — CID 146048117
16,17-dimethoxy-21-(3-pyridin-4-ylpropyl)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 146048117) has the molecular formula C28H27N2O4+ and a molecular weight of 455.53 g/mol. Its IUPAC name is 16,17-dimethoxy-21-(3-pyridin-4-ylpropyl)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 16,17-dimethoxy-21-(3-pyridin-4-ylpropyl)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 146048117 |
| Molecular Formula | C28H27N2O4+ |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 16,17-dimethoxy-21-(3-pyridin-4-ylpropyl)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | COc1ccc2c(CCCc3ccncc3)c3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C28H27N2O4/c1-31-24-7-6-20-21(5-3-4-18-8-11-29-12-9-18)27-22-15-26-25(33-17-34-26)14-19(22)10-13-30(27)16-23(20)28(24)32-2/h6-9,11-12,14-16H,3-5,10,13,17H2,1-2H3/q+1 |
| InChIKey | QVKHJFYKHMGTFF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 53.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|