C20H13F2N5 — CID 146048297
N,6-bis(4-fluorophenyl)-3-pyridin-2-yl-1,2,4-triazin-5-amine (PubChem CID 146048297) has the molecular formula C20H13F2N5 and a molecular weight of 361.36 g/mol. Its IUPAC name is N,6-bis(4-fluorophenyl)-3-pyridin-2-yl-1,2,4-triazin-5-amine.
| Compound Name | N,6-bis(4-fluorophenyl)-3-pyridin-2-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 146048297 |
| Molecular Formula | C20H13F2N5 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N,6-bis(4-fluorophenyl)-3-pyridin-2-yl-1,2,4-triazin-5-amine |
| SMILES | Fc1ccc(Nc2nc(-c3ccccn3)nnc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H13F2N5/c21-14-6-4-13(5-7-14)18-20(24-16-10-8-15(22)9-11-16)25-19(27-26-18)17-3-1-2-12-23-17/h1-12H,(H,24,25,27) |
| InChIKey | SMVDTEDLHPADRD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |