C29H25N3O4 — CID 146048392
N-[3-[2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-1-naphthalen-2-yl-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 146048392) has the molecular formula C29H25N3O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is N-[3-[2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-1-naphthalen-2-yl-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-1-naphthalen-2-yl-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 146048392 |
| Molecular Formula | C29H25N3O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-[3-[2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-1-naphthalen-2-yl-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(C=NNC(=O)C(=Cc2ccc3ccccc3c2)NC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C29H25N3O4/c1-35-26-15-13-21(18-27(26)36-2)19-30-32-29(34)25(31-28(33)23-9-4-3-5-10-23)17-20-12-14-22-8-6-7-11-24(22)16-20/h3-19H,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | UMMSNSQGRZATGK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|