C18H23N5O2S — CID 146048582
1-[(3aS,7aS)-2-acetyl-7a-(5-methyl-1H-1,2,4-triazol-3-yl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-thiophen-2-ylethanone (PubChem CID 146048582) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[(3aS,7aS)-2-acetyl-7a-(5-methyl-1H-1,2,4-triazol-3-yl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(3aS,7aS)-2-acetyl-7a-(5-methyl-1H-1,2,4-triazol-3-yl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 146048582 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[(3aS,7aS)-2-acetyl-7a-(5-methyl-1H-1,2,4-triazol-3-yl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-thiophen-2-ylethanone |
| SMILES | CC(=O)N1C[C@H]2CN(C(=O)Cc3cccs3)CC[C@@]2(c2n[nH]c(C)n2)C1 |
| InChI | InChI=1S/C18H23N5O2S/c1-12-19-17(21-20-12)18-5-6-22(16(25)8-15-4-3-7-26-15)9-14(18)10-23(11-18)13(2)24/h3-4,7,14H,5-6,8-11H2,1-2H3,(H,19,20,21)/t14-,18-/m1/s1 |
| InChIKey | RBPCALCYVVAQGY-RDTXWAMCSA-N |
| XLogP | 1.37 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |