C24H35N3O3 — CID 146048595
(1S,11R)-2-benzoyl-6-(2-ethylbutanoyl)-2,6,9-triazabicyclo[9.3.0]tetradecan-10-one (PubChem CID 146048595) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is (1S,11R)-2-benzoyl-6-(2-ethylbutanoyl)-2,6,9-triazabicyclo[9.3.0]tetradecan-10-one.
| Compound Name | (1S,11R)-2-benzoyl-6-(2-ethylbutanoyl)-2,6,9-triazabicyclo[9.3.0]tetradecan-10-one |
|---|---|
| PubChem CID | 146048595 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | (1S,11R)-2-benzoyl-6-(2-ethylbutanoyl)-2,6,9-triazabicyclo[9.3.0]tetradecan-10-one |
| SMILES | CCC(CC)C(=O)N1CCCN(C(=O)c2ccccc2)[C@H]2CCC[C@H]2C(=O)NCC1 |
| InChI | InChI=1S/C24H35N3O3/c1-3-18(4-2)23(29)26-15-9-16-27(24(30)19-10-6-5-7-11-19)21-13-8-12-20(21)22(28)25-14-17-26/h5-7,10-11,18,20-21H,3-4,8-9,12-17H2,1-2H3,(H,25,28)/t20-,21+/m1/s1 |
| InChIKey | HZWVDOCZZAOJHR-RTWAWAEBSA-N |
| XLogP | 3.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |