C25H21NO7 — CID 146048875
methyl 3-(6,7-dihydroxy-4-methyl-2-oxochromen-8-yl)-3-(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-10-yl)propanoate (PubChem CID 146048875) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is methyl 3-(6,7-dihydroxy-4-methyl-2-oxochromen-8-yl)-3-(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-10-yl)propanoate.
| Compound Name | methyl 3-(6,7-dihydroxy-4-methyl-2-oxochromen-8-yl)-3-(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-10-yl)propanoate |
|---|---|
| PubChem CID | 146048875 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | methyl 3-(6,7-dihydroxy-4-methyl-2-oxochromen-8-yl)-3-(11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-10-yl)propanoate |
| SMILES | COC(=O)CC(c1cc2cccc3c2n(c1=O)CC3)c1c(O)c(O)cc2c(C)cc(=O)oc12 |
| InChI | InChI=1S/C25H21NO7/c1-12-8-20(29)33-24-15(12)10-18(27)23(30)21(24)16(11-19(28)32-2)17-9-14-5-3-4-13-6-7-26(22(13)14)25(17)31/h3-5,8-10,16,27,30H,6-7,11H2,1-2H3 |
| InChIKey | DZCVIOBTSCIFEZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|