About [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride
[1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride (PubChem CID 146049020) has the molecular formula C7H11ClF2O2S
and a molecular weight of 232.68 g/mol. Its IUPAC name is [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride.
Molecular Properties
| Compound Name | [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride |
| PubChem CID | 146049020 |
| Molecular Formula | C7H11ClF2O2S |
| Molecular Weight | 232.68 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride |
| SMILES | CC(F)(F)C1(CS(=O)(=O)Cl)CCC1 |
| InChI | InChI=1S/C7H11ClF2O2S/c1-6(9,10)7(3-2-4-7)5-13(8,11)12/h2-5H2,1H3 |
| InChIKey | JTTGHEYQPSKJKC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride?
The IUPAC name of [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride (CID 146049020) is [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride.
What is the SMILES notation for [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride?
The canonical SMILES for [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride is CC(F)(F)C1(CS(=O)(=O)Cl)CCC1.
What is the InChIKey of [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride?
The InChIKey is JTTGHEYQPSKJKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClF2O2S/c1-6(9,10)7(3-2-4-7)5-13(8,11)12/h2-5H2,1H3.
What are the key properties of [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride?
[1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride has a molecular weight of 232.68 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,1-difluoroethyl)cyclobutyl]methanesulfonyl chloride is sourced from PubChem (CID 146049020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).