C12H21ClO — CID 146049034
2-chloro-1-(3,3,5,5-tetramethylcyclohexyl)ethanone (PubChem CID 146049034) has the molecular formula C12H21ClO and a molecular weight of 216.75 g/mol. Its IUPAC name is 2-chloro-1-(3,3,5,5-tetramethylcyclohexyl)ethanone.
| Compound Name | 2-chloro-1-(3,3,5,5-tetramethylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 146049034 |
| Molecular Formula | C12H21ClO |
| Molecular Weight | 216.75 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-chloro-1-(3,3,5,5-tetramethylcyclohexyl)ethanone |
| SMILES | CC1(C)CC(C(=O)CCl)CC(C)(C)C1 |
| InChI | InChI=1S/C12H21ClO/c1-11(2)5-9(10(14)7-13)6-12(3,4)8-11/h9H,5-8H2,1-4H3 |
| InChIKey | XUKJOSYMMNWLMQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|