2-piperidin-3-ylethanesulfonyl fluoride

C7H14FNO2S — CID 146049276

IUPAC2-piperidin-3-ylethanesulfonyl fluoride
SMILESO=S(=O)(F)CCC1CCCNC1
InChIInChI=1S/C7H14FNO2S/c8-12(10,11)5-3-7-2-1-4-9-6-7/h7,9H,1-6H2
InChIKeyRMTAOLSNLHMGNB-UHFFFAOYSA-N
MW195.26 g/mol
LogP0.68
Rot. Bonds3

About 2-piperidin-3-ylethanesulfonyl fluoride

2-piperidin-3-ylethanesulfonyl fluoride (PubChem CID 146049276) has the molecular formula C7H14FNO2S and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-piperidin-3-ylethanesulfonyl fluoride.

Molecular Properties

Compound Name2-piperidin-3-ylethanesulfonyl fluoride
PubChem CID146049276
Molecular FormulaC7H14FNO2S
Molecular Weight195.26 g/mol
Exact Mass195.07
IUPAC Name2-piperidin-3-ylethanesulfonyl fluoride
SMILESO=S(=O)(F)CCC1CCCNC1
InChIInChI=1S/C7H14FNO2S/c8-12(10,11)5-3-7-2-1-4-9-6-7/h7,9H,1-6H2
InChIKeyRMTAOLSNLHMGNB-UHFFFAOYSA-N
XLogP0.68
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.26
LogP ≤ 50.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-piperidin-3-ylethanesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-piperidin-3-ylethanesulfonyl fluoride?
The IUPAC name of 2-piperidin-3-ylethanesulfonyl fluoride (CID 146049276) is 2-piperidin-3-ylethanesulfonyl fluoride.
What is the SMILES notation for 2-piperidin-3-ylethanesulfonyl fluoride?
The canonical SMILES for 2-piperidin-3-ylethanesulfonyl fluoride is O=S(=O)(F)CCC1CCCNC1.
What is the InChIKey of 2-piperidin-3-ylethanesulfonyl fluoride?
The InChIKey is RMTAOLSNLHMGNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14FNO2S/c8-12(10,11)5-3-7-2-1-4-9-6-7/h7,9H,1-6H2.
What are the key properties of 2-piperidin-3-ylethanesulfonyl fluoride?
2-piperidin-3-ylethanesulfonyl fluoride has a molecular weight of 195.26 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-3-ylethanesulfonyl fluoride is sourced from PubChem (CID 146049276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).