About 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine
2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine (PubChem CID 146049415) has the molecular formula C5HBrClN3S
and a molecular weight of 250.51 g/mol. Its IUPAC name is 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine |
| PubChem CID | 146049415 |
| Molecular Formula | C5HBrClN3S |
| Molecular Weight | 250.51 g/mol |
| Exact Mass | 248.88 |
| IUPAC Name | 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine |
| SMILES | Clc1ncc2nc(Br)sc2n1 |
| InChI | InChI=1S/C5HBrClN3S/c6-4-9-2-1-8-5(7)10-3(2)11-4/h1H |
| InChIKey | TUXIEALZKDGHFT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine?
The IUPAC name of 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine (CID 146049415) is 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine?
The canonical SMILES for 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine is Clc1ncc2nc(Br)sc2n1.
What is the InChIKey of 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine?
The InChIKey is TUXIEALZKDGHFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HBrClN3S/c6-4-9-2-1-8-5(7)10-3(2)11-4/h1H.
What are the key properties of 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine?
2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine has a molecular weight of 250.51 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-chloro-[1,3]thiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 146049415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).