About (2S)-1,1-difluoropentan-2-amine;hydrochloride
(2S)-1,1-difluoropentan-2-amine;hydrochloride (PubChem CID 146049462) has the molecular formula C5H12ClF2N
and a molecular weight of 159.61 g/mol. Its IUPAC name is (2S)-1,1-difluoropentan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | (2S)-1,1-difluoropentan-2-amine;hydrochloride |
| PubChem CID | 146049462 |
| Molecular Formula | C5H12ClF2N |
| Molecular Weight | 159.61 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | (2S)-1,1-difluoropentan-2-amine;hydrochloride |
| SMILES | CCC[C@H](N)C(F)F.Cl |
| InChI | InChI=1S/C5H11F2N.ClH/c1-2-3-4(8)5(6)7;/h4-5H,2-3,8H2,1H3;1H/t4-;/m0./s1 |
| InChIKey | XVLSEJAYYHXEKQ-WCCKRBBISA-N |
| XLogP | 1.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.61 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-1,1-difluoropentan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,1-difluoropentan-2-amine;hydrochloride?
The IUPAC name of (2S)-1,1-difluoropentan-2-amine;hydrochloride (CID 146049462) is (2S)-1,1-difluoropentan-2-amine;hydrochloride.
What is the SMILES notation for (2S)-1,1-difluoropentan-2-amine;hydrochloride?
The canonical SMILES for (2S)-1,1-difluoropentan-2-amine;hydrochloride is CCC[C@H](N)C(F)F.Cl.
What is the InChIKey of (2S)-1,1-difluoropentan-2-amine;hydrochloride?
The InChIKey is XVLSEJAYYHXEKQ-WCCKRBBISA-N. The full InChI is InChI=1S/C5H11F2N.ClH/c1-2-3-4(8)5(6)7;/h4-5H,2-3,8H2,1H3;1H/t4-;/m0./s1.
What are the key properties of (2S)-1,1-difluoropentan-2-amine;hydrochloride?
(2S)-1,1-difluoropentan-2-amine;hydrochloride has a molecular weight of 159.61 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1-difluoropentan-2-amine;hydrochloride is sourced from PubChem (CID 146049462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).