About (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride
(E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride (PubChem CID 146049507) has the molecular formula C7H14ClNO2
and a molecular weight of 179.65 g/mol. Its IUPAC name is (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride |
| PubChem CID | 146049507 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride |
| SMILES | C/C(=C\C(C)CN)C(=O)O.Cl |
| InChI | InChI=1S/C7H13NO2.ClH/c1-5(4-8)3-6(2)7(9)10;/h3,5H,4,8H2,1-2H3,(H,9,10);1H/b6-3+; |
| InChIKey | HSOKECZEJMEPFQ-ZIKNSQGESA-N |
| XLogP | 1.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride?
The IUPAC name of (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride (CID 146049507) is (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride.
What is the SMILES notation for (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride?
The canonical SMILES for (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride is C/C(=C\C(C)CN)C(=O)O.Cl.
What is the InChIKey of (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride?
The InChIKey is HSOKECZEJMEPFQ-ZIKNSQGESA-N. The full InChI is InChI=1S/C7H13NO2.ClH/c1-5(4-8)3-6(2)7(9)10;/h3,5H,4,8H2,1-2H3,(H,9,10);1H/b6-3+;.
What are the key properties of (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride?
(E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride has a molecular weight of 179.65 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-amino-2,4-dimethylpent-2-enoic acid;hydrochloride is sourced from PubChem (CID 146049507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).