About 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride
5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride (PubChem CID 146049948) has the molecular formula C11H16ClNO2S
and a molecular weight of 261.77 g/mol. Its IUPAC name is 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride.
Molecular Properties
| Compound Name | 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride |
| PubChem CID | 146049948 |
| Molecular Formula | C11H16ClNO2S |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride |
| SMILES | Cl.O=S1(=O)CCNC(c2ccccc2)CC1 |
| InChI | InChI=1S/C11H15NO2S.ClH/c13-15(14)8-6-11(12-7-9-15)10-4-2-1-3-5-10;/h1-5,11-12H,6-9H2;1H |
| InChIKey | KIRJTVZHICZBLX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride?
The IUPAC name of 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride (CID 146049948) is 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride.
What is the SMILES notation for 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride?
The canonical SMILES for 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride is Cl.O=S1(=O)CCNC(c2ccccc2)CC1.
What is the InChIKey of 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride?
The InChIKey is KIRJTVZHICZBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S.ClH/c13-15(14)8-6-11(12-7-9-15)10-4-2-1-3-5-10;/h1-5,11-12H,6-9H2;1H.
What are the key properties of 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride?
5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride has a molecular weight of 261.77 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1,4-thiazepane 1,1-dioxide;hydrochloride is sourced from PubChem (CID 146049948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).