About sodium 2-(1H-1,2,4-triazol-5-yl)acetate
sodium 2-(1H-1,2,4-triazol-5-yl)acetate (PubChem CID 146050026) has the molecular formula C4H4N3NaO2
and a molecular weight of 149.09 g/mol. Its IUPAC name is sodium 2-(1H-1,2,4-triazol-5-yl)acetate.
Molecular Properties
| Compound Name | sodium 2-(1H-1,2,4-triazol-5-yl)acetate |
| PubChem CID | 146050026 |
| Molecular Formula | C4H4N3NaO2 |
| Molecular Weight | 149.09 g/mol |
| Exact Mass | 149.02 |
| IUPAC Name | sodium 2-(1H-1,2,4-triazol-5-yl)acetate |
| SMILES | O=C([O-])Cc1ncn[nH]1.[Na+] |
| InChI | InChI=1S/C4H5N3O2.Na/c8-4(9)1-3-5-2-6-7-3;/h2H,1H2,(H,8,9)(H,5,6,7);/q;+1/p-1 |
| InChIKey | KJIMPKQTYKEENY-UHFFFAOYSA-M |
| XLogP | -4.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.09 |
| LogP ≤ 5 | -4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium 2-(1H-1,2,4-triazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-(1H-1,2,4-triazol-5-yl)acetate?
The IUPAC name of sodium 2-(1H-1,2,4-triazol-5-yl)acetate (CID 146050026) is sodium 2-(1H-1,2,4-triazol-5-yl)acetate.
What is the SMILES notation for sodium 2-(1H-1,2,4-triazol-5-yl)acetate?
The canonical SMILES for sodium 2-(1H-1,2,4-triazol-5-yl)acetate is O=C([O-])Cc1ncn[nH]1.[Na+].
What is the InChIKey of sodium 2-(1H-1,2,4-triazol-5-yl)acetate?
The InChIKey is KJIMPKQTYKEENY-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H5N3O2.Na/c8-4(9)1-3-5-2-6-7-3;/h2H,1H2,(H,8,9)(H,5,6,7);/q;+1/p-1.
What are the key properties of sodium 2-(1H-1,2,4-triazol-5-yl)acetate?
sodium 2-(1H-1,2,4-triazol-5-yl)acetate has a molecular weight of 149.09 g/mol, XLogP of -4.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(1H-1,2,4-triazol-5-yl)acetate is sourced from PubChem (CID 146050026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).