C9H19ClN2O3S — CID 146050543
[(3aS,7aR)-2-methylsulfonyl-3,4,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-3a-yl]methanol;hydrochloride (PubChem CID 146050543) has the molecular formula C9H19ClN2O3S and a molecular weight of 270.78 g/mol. Its IUPAC name is [(3aS,7aR)-2-methylsulfonyl-3,4,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-3a-yl]methanol;hydrochloride.
| Compound Name | [(3aS,7aR)-2-methylsulfonyl-3,4,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-3a-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 146050543 |
| Molecular Formula | C9H19ClN2O3S |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | [(3aS,7aR)-2-methylsulfonyl-3,4,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-3a-yl]methanol;hydrochloride |
| SMILES | CS(=O)(=O)N1C[C@@H]2CCNC[C@]2(CO)C1.Cl |
| InChI | InChI=1S/C9H18N2O3S.ClH/c1-15(13,14)11-4-8-2-3-10-5-9(8,6-11)7-12;/h8,10,12H,2-7H2,1H3;1H/t8-,9+;/m0./s1 |
| InChIKey | DSSHUPORUSCGAM-OULXEKPRSA-N |
| XLogP | -0.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |