C21H26ClN3O3 — CID 146050753
3,3-dimethyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-4H-isoquinolin-1-amine;hydrochloride (PubChem CID 146050753) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 3,3-dimethyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-4H-isoquinolin-1-amine;hydrochloride.
| Compound Name | 3,3-dimethyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-4H-isoquinolin-1-amine;hydrochloride |
|---|---|
| PubChem CID | 146050753 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3,3-dimethyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-4H-isoquinolin-1-amine;hydrochloride |
| SMILES | COc1cc(/C=N/NC2=NC(C)(C)Cc3ccccc32)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C21H25N3O3.ClH/c1-21(2)12-15-8-6-7-9-16(15)20(23-21)24-22-13-14-10-17(25-3)19(27-5)18(11-14)26-4;/h6-11,13H,12H2,1-5H3,(H,23,24);1H/b22-13+; |
| InChIKey | AAOYRDHFXGCIPP-PNAHYYPNSA-N |
| XLogP | 3.84 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|