C20H26Cl2N4O3S — CID 146052300
N-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]benzenesulfonamide;dihydrochloride (PubChem CID 146052300) has the molecular formula C20H26Cl2N4O3S and a molecular weight of 473.43 g/mol. Its IUPAC name is N-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]benzenesulfonamide;dihydrochloride.
| Compound Name | N-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 146052300 |
| Molecular Formula | C20H26Cl2N4O3S |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | N-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]benzenesulfonamide;dihydrochloride |
| SMILES | COCCCN1CCn2c(nc3cc(NS(=O)(=O)c4ccccc4)ccc32)C1.Cl.Cl |
| InChI | InChI=1S/C20H24N4O3S.2ClH/c1-27-13-5-10-23-11-12-24-19-9-8-16(14-18(19)21-20(24)15-23)22-28(25,26)17-6-3-2-4-7-17;;/h2-4,6-9,14,22H,5,10-13,15H2,1H3;2*1H |
| InChIKey | BXLARDPEYOAUNU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|