C33H28O10 — CID 14605232
3,13,21-trihydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(29),2,4,6,8,10,17,20(25),21,23,27-undecaene-15,19,26-trione (PubChem CID 14605232) has the molecular formula C33H28O10 and a molecular weight of 584.58 g/mol. Its IUPAC name is 3,13,21-trihydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(29),2,4,6,8,10,17,20(25),21,23,27-undecaene-15,19,26-trione.
| Compound Name | 3,13,21-trihydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(29),2,4,6,8,10,17,20(25),21,23,27-undecaene-15,19,26-trione |
|---|---|
| PubChem CID | 14605232 |
| Molecular Formula | C33H28O10 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 3,13,21-trihydroxy-5,7,29-trimethoxy-13,23-dimethyl-16-oxahexacyclo[15.12.0.02,11.04,9.018,27.020,25]nonacosa-1(29),2,4,6,8,10,17,20(25),21,23,27-undecaene-15,19,26-trione |
| SMILES | COc1cc(OC)c2c(O)c3c(cc2c1)CC(C)(O)CC(=O)Oc1c2c(cc(OC)c1-3)C(=O)c1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C33H28O10/c1-14-6-18-26(20(34)7-14)31(38)27-19(29(18)36)11-22(42-5)28-25-16(12-33(2,39)13-23(35)43-32(27)28)8-15-9-17(40-3)10-21(41-4)24(15)30(25)37/h6-11,34,37,39H,12-13H2,1-5H3 |
| InChIKey | GMHTVISKDLAFHJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|