C22H19ClFN3O — CID 146052843
2-fluoro-N-[2-methyl-5-(6-methyl-1H-benzimidazol-2-yl)phenyl]benzamide;hydrochloride (PubChem CID 146052843) has the molecular formula C22H19ClFN3O and a molecular weight of 395.87 g/mol. Its IUPAC name is 2-fluoro-N-[2-methyl-5-(6-methyl-1H-benzimidazol-2-yl)phenyl]benzamide;hydrochloride.
| Compound Name | 2-fluoro-N-[2-methyl-5-(6-methyl-1H-benzimidazol-2-yl)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 146052843 |
| Molecular Formula | C22H19ClFN3O |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-fluoro-N-[2-methyl-5-(6-methyl-1H-benzimidazol-2-yl)phenyl]benzamide;hydrochloride |
| SMILES | Cc1ccc2nc(-c3ccc(C)c(NC(=O)c4ccccc4F)c3)[nH]c2c1.Cl |
| InChI | InChI=1S/C22H18FN3O.ClH/c1-13-7-10-18-20(11-13)25-21(24-18)15-9-8-14(2)19(12-15)26-22(27)16-5-3-4-6-17(16)23;/h3-12H,1-2H3,(H,24,25)(H,26,27);1H |
| InChIKey | VDUYPZZHJLZTGX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |