C22H25ClN4O — CID 146053191
1-(3-methylphenyl)-N-phenyl-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride (PubChem CID 146053191) has the molecular formula C22H25ClN4O and a molecular weight of 396.92 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-phenyl-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | 1-(3-methylphenyl)-N-phenyl-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146053191 |
| Molecular Formula | C22H25ClN4O |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-(3-methylphenyl)-N-phenyl-5-piperidin-4-ylpyrazole-4-carboxamide;hydrochloride |
| SMILES | Cc1cccc(-n2ncc(C(=O)Nc3ccccc3)c2C2CCNCC2)c1.Cl |
| InChI | InChI=1S/C22H24N4O.ClH/c1-16-6-5-9-19(14-16)26-21(17-10-12-23-13-11-17)20(15-24-26)22(27)25-18-7-3-2-4-8-18;/h2-9,14-15,17,23H,10-13H2,1H3,(H,25,27);1H |
| InChIKey | RJYVDHXXWNFQKI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |