C24H38F3N3O5S — CID 146056500
4-(2-methylpropyl)-N-(3-oxo-3-piperazin-1-ylpropyl)-N-pentylbenzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 146056500) has the molecular formula C24H38F3N3O5S and a molecular weight of 537.65 g/mol. Its IUPAC name is 4-(2-methylpropyl)-N-(3-oxo-3-piperazin-1-ylpropyl)-N-pentylbenzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(2-methylpropyl)-N-(3-oxo-3-piperazin-1-ylpropyl)-N-pentylbenzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146056500 |
| Molecular Formula | C24H38F3N3O5S |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 4-(2-methylpropyl)-N-(3-oxo-3-piperazin-1-ylpropyl)-N-pentylbenzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCN(CCC(=O)N1CCNCC1)S(=O)(=O)c1ccc(CC(C)C)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H37N3O3S.C2HF3O2/c1-4-5-6-14-25(15-11-22(26)24-16-12-23-13-17-24)29(27,28)21-9-7-20(8-10-21)18-19(2)3;3-2(4,5)1(6)7/h7-10,19,23H,4-6,11-18H2,1-3H3;(H,6,7) |
| InChIKey | XWUZAHXFRZPKEH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|