C27H33ClF3N3O5 — CID 146057598
4-butoxy-N-[(3-chlorophenyl)methyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 146057598) has the molecular formula C27H33ClF3N3O5 and a molecular weight of 572.02 g/mol. Its IUPAC name is 4-butoxy-N-[(3-chlorophenyl)methyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-butoxy-N-[(3-chlorophenyl)methyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146057598 |
| Molecular Formula | C27H33ClF3N3O5 |
| Molecular Weight | 572.02 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 4-butoxy-N-[(3-chlorophenyl)methyl]-N-(3-oxo-3-piperazin-1-ylpropyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCOc1ccc(C(=O)N(CCC(=O)N2CCNCC2)Cc2cccc(Cl)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H32ClN3O3.C2HF3O2/c1-2-3-17-32-23-9-7-21(8-10-23)25(31)29(19-20-5-4-6-22(26)18-20)14-11-24(30)28-15-12-27-13-16-28;3-2(4,5)1(6)7/h4-10,18,27H,2-3,11-17,19H2,1H3;(H,6,7) |
| InChIKey | GIQUGXFRONHCEQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.02 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|