C20H27BrF3N3O4 — CID 146058421
3-bromo-N-(2-oxo-2-piperazin-1-ylethyl)-N-pentylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 146058421) has the molecular formula C20H27BrF3N3O4 and a molecular weight of 510.35 g/mol. Its IUPAC name is 3-bromo-N-(2-oxo-2-piperazin-1-ylethyl)-N-pentylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-bromo-N-(2-oxo-2-piperazin-1-ylethyl)-N-pentylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146058421 |
| Molecular Formula | C20H27BrF3N3O4 |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 3-bromo-N-(2-oxo-2-piperazin-1-ylethyl)-N-pentylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCN(CC(=O)N1CCNCC1)C(=O)c1cccc(Br)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26BrN3O2.C2HF3O2/c1-2-3-4-10-22(14-17(23)21-11-8-20-9-12-21)18(24)15-6-5-7-16(19)13-15;3-2(4,5)1(6)7/h5-7,13,20H,2-4,8-12,14H2,1H3;(H,6,7) |
| InChIKey | WINWVRSLDNZICE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|