C28H25F4N3O7 — CID 146060752
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-[(4-fluorobenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060752) has the molecular formula C28H25F4N3O7 and a molecular weight of 591.51 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-[(4-fluorobenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-[(4-fluorobenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060752 |
| Molecular Formula | C28H25F4N3O7 |
| Molecular Weight | 591.51 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-[(4-fluorobenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c(C(=O)O)c1)c1ccc(F)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H24FN3O5.C2HF3O2/c27-19-4-2-18(3-5-19)25(31)28-20-6-7-22(21(14-20)26(32)33)30-11-9-29(10-12-30)15-17-1-8-23-24(13-17)35-16-34-23;3-2(4,5)1(6)7/h1-8,13-14H,9-12,15-16H2,(H,28,31)(H,32,33);(H,6,7) |
| InChIKey | DWKHXVDEYPOVEH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|