C31H46O2Si — CID 14606283
(5S,8R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methyl-5-propan-2-yldeca-1,9-dien-4-ol (PubChem CID 14606283) has the molecular formula C31H46O2Si and a molecular weight of 478.79 g/mol. Its IUPAC name is (5S,8R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methyl-5-propan-2-yldeca-1,9-dien-4-ol.
| Compound Name | (5S,8R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methyl-5-propan-2-yldeca-1,9-dien-4-ol |
|---|---|
| PubChem CID | 14606283 |
| Molecular Formula | C31H46O2Si |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | (5S,8R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methyl-5-propan-2-yldeca-1,9-dien-4-ol |
| SMILES | C=C[C@H](C)CC[C@@H](C(C)C)C(O)CC(=C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H46O2Si/c1-9-25(4)20-21-29(24(2)3)30(32)22-26(5)23-33-34(31(6,7)8,27-16-12-10-13-17-27)28-18-14-11-15-19-28/h9-19,24-25,29-30,32H,1,5,20-23H2,2-4,6-8H3/t25-,29-,30?/m0/s1 |
| InChIKey | AJBYLUXJKNITJT-CVCBDUNSSA-N |
| XLogP | 6.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|