C24H31ClF2N4O2S — CID 146063228
N-[(3,5-difluorophenyl)methyl]-9-(2,4,5-trimethylphenyl)sulfonyl-1,4,9-triazaspiro[5.5]undec-4-en-5-amine;hydrochloride (PubChem CID 146063228) has the molecular formula C24H31ClF2N4O2S and a molecular weight of 513.05 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-9-(2,4,5-trimethylphenyl)sulfonyl-1,4,9-triazaspiro[5.5]undec-4-en-5-amine;hydrochloride.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-9-(2,4,5-trimethylphenyl)sulfonyl-1,4,9-triazaspiro[5.5]undec-4-en-5-amine;hydrochloride |
|---|---|
| PubChem CID | 146063228 |
| Molecular Formula | C24H31ClF2N4O2S |
| Molecular Weight | 513.05 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-9-(2,4,5-trimethylphenyl)sulfonyl-1,4,9-triazaspiro[5.5]undec-4-en-5-amine;hydrochloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC3(CC2)NCCN=C3NCc2cc(F)cc(F)c2)cc1C.Cl |
| InChI | InChI=1S/C24H30F2N4O2S.ClH/c1-16-10-18(3)22(11-17(16)2)33(31,32)30-8-4-24(5-9-30)23(27-6-7-29-24)28-15-19-12-20(25)14-21(26)13-19;/h10-14,29H,4-9,15H2,1-3H3,(H,27,28);1H |
| InChIKey | XHENZYQMYOCGCM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.05 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |