C17H24Cl2FN3 — CID 146065255
3-[[1-[(4-fluorophenyl)methyl]-5-methylimidazol-2-yl]methyl]piperidine;dihydrochloride (PubChem CID 146065255) has the molecular formula C17H24Cl2FN3 and a molecular weight of 360.30 g/mol. Its IUPAC name is 3-[[1-[(4-fluorophenyl)methyl]-5-methylimidazol-2-yl]methyl]piperidine;dihydrochloride.
| Compound Name | 3-[[1-[(4-fluorophenyl)methyl]-5-methylimidazol-2-yl]methyl]piperidine;dihydrochloride |
|---|---|
| PubChem CID | 146065255 |
| Molecular Formula | C17H24Cl2FN3 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-[[1-[(4-fluorophenyl)methyl]-5-methylimidazol-2-yl]methyl]piperidine;dihydrochloride |
| SMILES | Cc1cnc(CC2CCCNC2)n1Cc1ccc(F)cc1.Cl.Cl |
| InChI | InChI=1S/C17H22FN3.2ClH/c1-13-10-20-17(9-15-3-2-8-19-11-15)21(13)12-14-4-6-16(18)7-5-14;;/h4-7,10,15,19H,2-3,8-9,11-12H2,1H3;2*1H |
| InChIKey | PZCGWVOBFJGKAO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |