C20H30N8O3 — CID 146067524
1,1-diethyl-3-[[1'-(1-ethylpyrazole-4-carbonyl)spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-pyrrolidine]-3-yl]methyl]urea (PubChem CID 146067524) has the molecular formula C20H30N8O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1,1-diethyl-3-[[1'-(1-ethylpyrazole-4-carbonyl)spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-pyrrolidine]-3-yl]methyl]urea.
| Compound Name | 1,1-diethyl-3-[[1'-(1-ethylpyrazole-4-carbonyl)spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-pyrrolidine]-3-yl]methyl]urea |
|---|---|
| PubChem CID | 146067524 |
| Molecular Formula | C20H30N8O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 1,1-diethyl-3-[[1'-(1-ethylpyrazole-4-carbonyl)spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-pyrrolidine]-3-yl]methyl]urea |
| SMILES | CCN(CC)C(=O)NCc1nnn2c1COC1(CCN(C(=O)c3cnn(CC)c3)C1)C2 |
| InChI | InChI=1S/C20H30N8O3/c1-4-25(5-2)19(30)21-10-16-17-12-31-20(14-28(17)24-23-16)7-8-26(13-20)18(29)15-9-22-27(6-3)11-15/h9,11H,4-8,10,12-14H2,1-3H3,(H,21,30) |
| InChIKey | IHKFIGFKWWGJNH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |