C20H32N8O2 — CID 146067622
3-[[1'-[(1,3-dimethylpyrazol-4-yl)methyl]spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-pyrrolidine]-3-yl]methyl]-1,1-diethylurea (PubChem CID 146067622) has the molecular formula C20H32N8O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 3-[[1'-[(1,3-dimethylpyrazol-4-yl)methyl]spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-pyrrolidine]-3-yl]methyl]-1,1-diethylurea.
| Compound Name | 3-[[1'-[(1,3-dimethylpyrazol-4-yl)methyl]spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-pyrrolidine]-3-yl]methyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 146067622 |
| Molecular Formula | C20H32N8O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 3-[[1'-[(1,3-dimethylpyrazol-4-yl)methyl]spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-pyrrolidine]-3-yl]methyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCc1nnn2c1COC1(CCN(Cc3cn(C)nc3C)C1)C2 |
| InChI | InChI=1S/C20H32N8O2/c1-5-27(6-2)19(29)21-9-17-18-12-30-20(14-28(18)24-22-17)7-8-26(13-20)11-16-10-25(4)23-15(16)3/h10H,5-9,11-14H2,1-4H3,(H,21,29) |
| InChIKey | FXMBWIVMKLNUGN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |