C20H28N4O3 — CID 146068911
6,6-dimethyl-2-(2-methylpropyl)-8-(2-pyridin-4-ylacetyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione (PubChem CID 146068911) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 6,6-dimethyl-2-(2-methylpropyl)-8-(2-pyridin-4-ylacetyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione.
| Compound Name | 6,6-dimethyl-2-(2-methylpropyl)-8-(2-pyridin-4-ylacetyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione |
|---|---|
| PubChem CID | 146068911 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 6,6-dimethyl-2-(2-methylpropyl)-8-(2-pyridin-4-ylacetyl)-5,7,9,9a-tetrahydroimidazo[1,5-a][1,4]diazepine-1,3-dione |
| SMILES | CC(C)CN1C(=O)C2CN(C(=O)Cc3ccncc3)CC(C)(C)CN2C1=O |
| InChI | InChI=1S/C20H28N4O3/c1-14(2)10-23-18(26)16-11-22(12-20(3,4)13-24(16)19(23)27)17(25)9-15-5-7-21-8-6-15/h5-8,14,16H,9-13H2,1-4H3 |
| InChIKey | SCQAEONKCASSOH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|