About 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine]
1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] (PubChem CID 146069438) has the molecular formula C18H22N4O
and a molecular weight of 310.40 g/mol. Its IUPAC name is 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine].
Molecular Properties
| Compound Name | 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] |
| PubChem CID | 146069438 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] |
| SMILES | CCCc1ncc2c(n1)COC21CN(Cc2ccc(C)cn2)C1 |
| InChI | InChI=1S/C18H22N4O/c1-3-4-17-20-8-15-16(21-17)10-23-18(15)11-22(12-18)9-14-6-5-13(2)7-19-14/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | DAZHKIZIEQKAQI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine]?
The IUPAC name of 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] (CID 146069438) is 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine].
What is the SMILES notation for 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine]?
The canonical SMILES for 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] is CCCc1ncc2c(n1)COC21CN(Cc2ccc(C)cn2)C1.
What is the InChIKey of 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine]?
The InChIKey is DAZHKIZIEQKAQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O/c1-3-4-17-20-8-15-16(21-17)10-23-18(15)11-22(12-18)9-14-6-5-13(2)7-19-14/h5-8H,3-4,9-12H2,1-2H3.
What are the key properties of 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine]?
1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] has a molecular weight of 310.40 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[(5-methyl-2-pyridinyl)methyl]-2-propylspiro[7H-furo[3,4-d]pyrimidine-5,3'-azetidine] is sourced from PubChem (CID 146069438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).