C23H28N6O4 — CID 146069659
1-ethyl-N-[(1S,2R,4R)-4-(2-methoxyethylcarbamoyl)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclopentyl]pyrazole-4-carboxamide (PubChem CID 146069659) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-ethyl-N-[(1S,2R,4R)-4-(2-methoxyethylcarbamoyl)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclopentyl]pyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-[(1S,2R,4R)-4-(2-methoxyethylcarbamoyl)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclopentyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 146069659 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1-ethyl-N-[(1S,2R,4R)-4-(2-methoxyethylcarbamoyl)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclopentyl]pyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)N[C@H]2C[C@H](C(=O)NCCOC)C[C@H]2c2nc(-c3ccccc3)no2)cn1 |
| InChI | InChI=1S/C23H28N6O4/c1-3-29-14-17(13-25-29)22(31)26-19-12-16(21(30)24-9-10-32-2)11-18(19)23-27-20(28-33-23)15-7-5-4-6-8-15/h4-8,13-14,16,18-19H,3,9-12H2,1-2H3,(H,24,30)(H,26,31)/t16-,18-,19+/m1/s1 |
| InChIKey | QZKJQMBCZCACHZ-QRQLOZEOSA-N |
| XLogP | 2.01 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|