C15H24O3 — CID 14606994
(1R,4R,6R,9E,11R)-9-(hydroperoxymethyl)-4,12,12-trimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene (PubChem CID 14606994) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1R,4R,6R,9E,11R)-9-(hydroperoxymethyl)-4,12,12-trimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene.
| Compound Name | (1R,4R,6R,9E,11R)-9-(hydroperoxymethyl)-4,12,12-trimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene |
|---|---|
| PubChem CID | 14606994 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1R,4R,6R,9E,11R)-9-(hydroperoxymethyl)-4,12,12-trimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene |
| SMILES | CC1(C)[C@@H]2/C=C(/COO)CC[C@H]3O[C@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C15H24O3/c1-14(2)11-6-7-15(3)13(18-15)5-4-10(9-17-16)8-12(11)14/h8,11-13,16H,4-7,9H2,1-3H3/b10-8+/t11-,12-,13-,15-/m1/s1 |
| InChIKey | WMKOXLOLBDIFPW-KDXTWHERSA-N |
| XLogP | 3.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|