C19H27N3O3 — CID 146069999
(5aS,9aR)-4-methyl-7-[(4-propoxyphenyl)methyl]-3,5a,6,8,9,9a-hexahydro-1H-pyrido[4,3-e][1,4]diazepine-2,5-dione (PubChem CID 146069999) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (5aS,9aR)-4-methyl-7-[(4-propoxyphenyl)methyl]-3,5a,6,8,9,9a-hexahydro-1H-pyrido[4,3-e][1,4]diazepine-2,5-dione.
| Compound Name | (5aS,9aR)-4-methyl-7-[(4-propoxyphenyl)methyl]-3,5a,6,8,9,9a-hexahydro-1H-pyrido[4,3-e][1,4]diazepine-2,5-dione |
|---|---|
| PubChem CID | 146069999 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (5aS,9aR)-4-methyl-7-[(4-propoxyphenyl)methyl]-3,5a,6,8,9,9a-hexahydro-1H-pyrido[4,3-e][1,4]diazepine-2,5-dione |
| SMILES | CCCOc1ccc(CN2CC[C@H]3NC(=O)CN(C)C(=O)[C@H]3C2)cc1 |
| InChI | InChI=1S/C19H27N3O3/c1-3-10-25-15-6-4-14(5-7-15)11-22-9-8-17-16(12-22)19(24)21(2)13-18(23)20-17/h4-7,16-17H,3,8-13H2,1-2H3,(H,20,23)/t16-,17+/m0/s1 |
| InChIKey | OTZPUMDZJJLQLU-DLBZAZTESA-N |
| XLogP | 1.25 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |