C16H18N4O3 — CID 146070267
8-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-one (PubChem CID 146070267) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 8-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-one.
| Compound Name | 8-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 146070267 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 8-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-one |
| SMILES | Cn1nc2n(c1=O)CCOC2CC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H18N4O3/c1-18-16(22)20-8-9-23-13(15(20)17-18)10-14(21)19-7-6-11-4-2-3-5-12(11)19/h2-5,13H,6-10H2,1H3 |
| InChIKey | CLWKPVHVJVWURT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |