C23H36N4O5S — CID 146070612
(4S,5S)-N-[3-[benzyl(ethyl)amino]propyl]-10-oxo-2-propan-2-ylsulfonyl-6-oxa-2,9-diazaspiro[4.5]decane-4-carboxamide (PubChem CID 146070612) has the molecular formula C23H36N4O5S and a molecular weight of 480.63 g/mol. Its IUPAC name is (4S,5S)-N-[3-[benzyl(ethyl)amino]propyl]-10-oxo-2-propan-2-ylsulfonyl-6-oxa-2,9-diazaspiro[4.5]decane-4-carboxamide.
| Compound Name | (4S,5S)-N-[3-[benzyl(ethyl)amino]propyl]-10-oxo-2-propan-2-ylsulfonyl-6-oxa-2,9-diazaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 146070612 |
| Molecular Formula | C23H36N4O5S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | (4S,5S)-N-[3-[benzyl(ethyl)amino]propyl]-10-oxo-2-propan-2-ylsulfonyl-6-oxa-2,9-diazaspiro[4.5]decane-4-carboxamide |
| SMILES | CCN(CCCNC(=O)[C@H]1CN(S(=O)(=O)C(C)C)C[C@@]12OCCNC2=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H36N4O5S/c1-4-26(15-19-9-6-5-7-10-19)13-8-11-24-21(28)20-16-27(33(30,31)18(2)3)17-23(20)22(29)25-12-14-32-23/h5-7,9-10,18,20H,4,8,11-17H2,1-3H3,(H,24,28)(H,25,29)/t20-,23-/m1/s1 |
| InChIKey | UDBRKKQTZXMNGD-NFBKMPQASA-N |
| XLogP | 0.57 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|