C16H19ClN2O4S — CID 146072768
8-(2-chloropropanoyl)-1,1-dioxo-4-phenyl-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 146072768) has the molecular formula C16H19ClN2O4S and a molecular weight of 370.86 g/mol. Its IUPAC name is 8-(2-chloropropanoyl)-1,1-dioxo-4-phenyl-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-(2-chloropropanoyl)-1,1-dioxo-4-phenyl-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 146072768 |
| Molecular Formula | C16H19ClN2O4S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 8-(2-chloropropanoyl)-1,1-dioxo-4-phenyl-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CC(Cl)C(=O)N1CCC2(CC1)N(c1ccccc1)C(=O)CS2(=O)=O |
| InChI | InChI=1S/C16H19ClN2O4S/c1-12(17)15(21)18-9-7-16(8-10-18)19(13-5-3-2-4-6-13)14(20)11-24(16,22)23/h2-6,12H,7-11H2,1H3 |
| InChIKey | BNVAWELIMNZLHX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|