C33H34INO6S — CID 14607305
N-[(2S,3S,4S,5R,6R)-3-iodo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzenesulfonamide (PubChem CID 14607305) has the molecular formula C33H34INO6S and a molecular weight of 699.61 g/mol. Its IUPAC name is N-[(2S,3S,4S,5R,6R)-3-iodo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzenesulfonamide.
| Compound Name | N-[(2S,3S,4S,5R,6R)-3-iodo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 14607305 |
| Molecular Formula | C33H34INO6S |
| Molecular Weight | 699.61 g/mol |
| Exact Mass | 699.12 |
| IUPAC Name | N-[(2S,3S,4S,5R,6R)-3-iodo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1I)c1ccccc1 |
| InChI | InChI=1S/C33H34INO6S/c34-30-32(40-23-27-17-9-3-10-18-27)31(39-22-26-15-7-2-8-16-26)29(24-38-21-25-13-5-1-6-14-25)41-33(30)35-42(36,37)28-19-11-4-12-20-28/h1-20,29-33,35H,21-24H2/t29-,30+,31-,32-,33+/m1/s1 |
| InChIKey | DKTIKLXDKZUMIR-GGJJTXTCSA-N |
| XLogP | 5.88 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|