C45H53NO12S — CID 14607318
N-[4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methoxy]oxan-3-yl]benzenesulfonamide (PubChem CID 14607318) has the molecular formula C45H53NO12S and a molecular weight of 831.98 g/mol. Its IUPAC name is N-[4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methoxy]oxan-3-yl]benzenesulfonamide.
| Compound Name | N-[4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methoxy]oxan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 14607318 |
| Molecular Formula | C45H53NO12S |
| Molecular Weight | 831.98 g/mol |
| Exact Mass | 831.33 |
| IUPAC Name | N-[4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methoxy]oxan-3-yl]benzenesulfonamide |
| SMILES | CC1(C)OC2OC(COC3OC(COCc4ccccc4)C(OCc4ccccc4)C(OCc4ccccc4)C3NS(=O)(=O)c3ccccc3)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C45H53NO12S/c1-44(2)55-38-35(54-43-41(40(38)56-44)57-45(3,4)58-43)29-52-42-36(46-59(47,48)33-23-15-8-16-24-33)39(51-27-32-21-13-7-14-22-32)37(50-26-31-19-11-6-12-20-31)34(53-42)28-49-25-30-17-9-5-10-18-30/h5-24,34-43,46H,25-29H2,1-4H3 |
| InChIKey | PVPUASMWBXTTPV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.98 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |