About 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol
5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 14607363) has the molecular formula C6H10F2O4
and a molecular weight of 184.14 g/mol. Its IUPAC name is 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol.
Molecular Properties
| Compound Name | 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol |
| PubChem CID | 14607363 |
| Molecular Formula | C6H10F2O4 |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OCC1OC(F)C(F)C(O)C1O |
| InChI | InChI=1S/C6H10F2O4/c7-3-5(11)4(10)2(1-9)12-6(3)8/h2-6,9-11H,1H2 |
| InChIKey | YZRDPODBASCWCK-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol?
The IUPAC name of 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol (CID 14607363) is 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol.
What is the SMILES notation for 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol?
The canonical SMILES for 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol is OCC1OC(F)C(F)C(O)C1O.
What is the InChIKey of 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol?
The InChIKey is YZRDPODBASCWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2O4/c7-3-5(11)4(10)2(1-9)12-6(3)8/h2-6,9-11H,1H2.
What are the key properties of 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol?
5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol has a molecular weight of 184.14 g/mol, XLogP of -1.27, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol is sourced from PubChem (CID 14607363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).