C18H25N7 — CID 146074375
4-[4-(6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]-N-ethylpyrimidin-2-amine (PubChem CID 146074375) has the molecular formula C18H25N7 and a molecular weight of 339.45 g/mol. Its IUPAC name is 4-[4-(6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]-N-ethylpyrimidin-2-amine.
| Compound Name | 4-[4-(6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 146074375 |
| Molecular Formula | C18H25N7 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 4-[4-(6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]-N-ethylpyrimidin-2-amine |
| SMILES | CCNc1nccc(N2CCN(c3cc(C4CCC4)ncn3)CC2)n1 |
| InChI | InChI=1S/C18H25N7/c1-2-19-18-20-7-6-16(23-18)24-8-10-25(11-9-24)17-12-15(21-13-22-17)14-4-3-5-14/h6-7,12-14H,2-5,8-11H2,1H3,(H,19,20,23) |
| InChIKey | PXZJJEBFJLYIFL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |