About (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one
(2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one (PubChem CID 14607526) has the molecular formula C22H40O2
and a molecular weight of 336.56 g/mol. Its IUPAC name is (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one |
| PubChem CID | 14607526 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one |
| SMILES | CCCCCCCCCCC[C@H]1CC=C(CCCCCC)C(=O)O1 |
| InChI | InChI=1S/C22H40O2/c1-3-5-7-9-10-11-12-13-15-17-21-19-18-20(22(23)24-21)16-14-8-6-4-2/h18,21H,3-17,19H2,1-2H3/t21-/m0/s1 |
| InChIKey | PNTFVBMYNOKWQP-NRFANRHFSA-N |
| XLogP | 7.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one?
The IUPAC name of (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one (CID 14607526) is (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one.
What is the SMILES notation for (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one?
The canonical SMILES for (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one is CCCCCCCCCCC[C@H]1CC=C(CCCCCC)C(=O)O1.
What is the InChIKey of (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one?
The InChIKey is PNTFVBMYNOKWQP-NRFANRHFSA-N. The full InChI is InChI=1S/C22H40O2/c1-3-5-7-9-10-11-12-13-15-17-21-19-18-20(22(23)24-21)16-14-8-6-4-2/h18,21H,3-17,19H2,1-2H3/t21-/m0/s1.
What are the key properties of (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one?
(2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one has a molecular weight of 336.56 g/mol, XLogP of 7.12, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-hexyl-2-undecyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 14607526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).