About O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride
O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride (PubChem CID 146075476) has the molecular formula C4H10Cl2N4O
and a molecular weight of 201.06 g/mol. Its IUPAC name is O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride.
Molecular Properties
| Compound Name | O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride |
| PubChem CID | 146075476 |
| Molecular Formula | C4H10Cl2N4O |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride |
| SMILES | C[C@H](ON)c1ncn[nH]1.Cl.Cl |
| InChI | InChI=1S/C4H8N4O.2ClH/c1-3(9-5)4-6-2-7-8-4;;/h2-3H,5H2,1H3,(H,6,7,8);2*1H/t3-;;/m0../s1 |
| InChIKey | PCABDOHBKMMHMK-QTNFYWBSSA-N |
| XLogP | 0.60 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride?
The IUPAC name of O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride (CID 146075476) is O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride.
What is the SMILES notation for O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride?
The canonical SMILES for O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride is C[C@H](ON)c1ncn[nH]1.Cl.Cl.
What is the InChIKey of O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride?
The InChIKey is PCABDOHBKMMHMK-QTNFYWBSSA-N. The full InChI is InChI=1S/C4H8N4O.2ClH/c1-3(9-5)4-6-2-7-8-4;;/h2-3H,5H2,1H3,(H,6,7,8);2*1H/t3-;;/m0../s1.
What are the key properties of O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride?
O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride has a molecular weight of 201.06 g/mol, XLogP of 0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine;dihydrochloride is sourced from PubChem (CID 146075476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).