About O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine
O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine (PubChem CID 146075477) has the molecular formula C4H8N4O
and a molecular weight of 128.13 g/mol. Its IUPAC name is O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine |
| PubChem CID | 146075477 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine |
| SMILES | C[C@H](ON)c1ncn[nH]1 |
| InChI | InChI=1S/C4H8N4O/c1-3(9-5)4-6-2-7-8-4/h2-3H,5H2,1H3,(H,6,7,8)/t3-/m0/s1 |
| InChIKey | WKVIFJBXEOKFRJ-VKHMYHEASA-N |
| XLogP | -0.24 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine?
The IUPAC name of O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine (CID 146075477) is O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine.
What is the SMILES notation for O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine?
The canonical SMILES for O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine is C[C@H](ON)c1ncn[nH]1.
What is the InChIKey of O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine?
The InChIKey is WKVIFJBXEOKFRJ-VKHMYHEASA-N. The full InChI is InChI=1S/C4H8N4O/c1-3(9-5)4-6-2-7-8-4/h2-3H,5H2,1H3,(H,6,7,8)/t3-/m0/s1.
What are the key properties of O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine?
O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine has a molecular weight of 128.13 g/mol, XLogP of -0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]hydroxylamine is sourced from PubChem (CID 146075477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).