C19H27N5O3 — CID 146076388
[4-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]piperidin-1-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone (PubChem CID 146076388) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is [4-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]piperidin-1-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone.
| Compound Name | [4-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]piperidin-1-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 146076388 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | [4-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]piperidin-1-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone |
| SMILES | Cc1nc(CC2CCN(C(=O)c3c4c(nn3C)[C@H](C)O[C@H](C)C4)CC2)no1 |
| InChI | InChI=1S/C19H27N5O3/c1-11-9-15-17(12(2)26-11)21-23(4)18(15)19(25)24-7-5-14(6-8-24)10-16-20-13(3)27-22-16/h11-12,14H,5-10H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | MSOIQDAFRRVRME-NEPJUHHUSA-N |
| XLogP | 2.23 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |