C13H18F3N3O — CID 146076707
(E)-4-(dimethylamino)-N-[2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]but-2-enamide (PubChem CID 146076707) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]but-2-enamide |
|---|---|
| PubChem CID | 146076707 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)NC(c1ccn(C)c1)C(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O/c1-18(2)7-4-5-11(20)17-12(13(14,15)16)10-6-8-19(3)9-10/h4-6,8-9,12H,7H2,1-3H3,(H,17,20)/b5-4+ |
| InChIKey | HLJSOEVFFDVOSJ-SNAWJCMRSA-N |
| XLogP | 1.86 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|