C13H19F2N3O3 — CID 146076948
(5R,7S)-N-(2,2-difluoro-3-hydroxypropyl)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide (PubChem CID 146076948) has the molecular formula C13H19F2N3O3 and a molecular weight of 303.31 g/mol. Its IUPAC name is (5R,7S)-N-(2,2-difluoro-3-hydroxypropyl)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-(2,2-difluoro-3-hydroxypropyl)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146076948 |
| Molecular Formula | C13H19F2N3O3 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (5R,7S)-N-(2,2-difluoro-3-hydroxypropyl)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(nn(C)c2C(=O)NCC(F)(F)CO)[C@H](C)O1 |
| InChI | InChI=1S/C13H19F2N3O3/c1-7-4-9-10(8(2)21-7)17-18(3)11(9)12(20)16-5-13(14,15)6-19/h7-8,19H,4-6H2,1-3H3,(H,16,20)/t7-,8+/m1/s1 |
| InChIKey | BINZWUXQGIOCDH-SFYZADRCSA-N |
| XLogP | 0.80 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |