About 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one
6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one (PubChem CID 146077602) has the molecular formula C12H14N6O2
and a molecular weight of 274.28 g/mol. Its IUPAC name is 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 146077602 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCc1onc(C)c1Cn1cnc2c(nnn2C)c1=O |
| InChI | InChI=1S/C12H14N6O2/c1-4-9-8(7(2)15-20-9)5-18-6-13-11-10(12(18)19)14-16-17(11)3/h6H,4-5H2,1-3H3 |
| InChIKey | DGBSTQSZRRPMKO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one (CID 146077602) is 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one is CCc1onc(C)c1Cn1cnc2c(nnn2C)c1=O.
What is the InChIKey of 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one?
The InChIKey is DGBSTQSZRRPMKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N6O2/c1-4-9-8(7(2)15-20-9)5-18-6-13-11-10(12(18)19)14-16-17(11)3/h6H,4-5H2,1-3H3.
What are the key properties of 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one?
6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one has a molecular weight of 274.28 g/mol, XLogP of 0.43, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-ethyl-3-methyl-1,2-oxazol-4-yl)methyl]-3-methyltriazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 146077602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).